N-(2-Hydroxyethyl)phthalimide
Catalog No: FT-0676029
CAS No: 3891-07-4
- Chemical Name: N-(2-Hydroxyethyl)phthalimide
- Molecular Formula: C10H9NO3
- Molecular Weight: 191.18
- InChI Key: MWFLUYFYHANMCM-UHFFFAOYSA-N
- InChI: InChI=1S/C10H9NO3/c12-6-5-11-9(13)7-3-1-2-4-8(7)10(11)14/h1-4,12H,5-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3891-07-4 |
| Flash_Point: | 169.4±23.2 °C |
| Product_Name: | N-Hydroxyethylphthalimide |
| Bolling_Point: | 356.5±25.0 °C at 760 mmHg |
| FW: | 191.183 |
| Melting_Point: | 126-128 °C(lit.) |
| MF: | C10H9NO3 |
| Density: | 1.4±0.1 g/cm3 |
| Refractive_Index: | 1.622 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 169.4±23.2 °C |
| LogP: | 0.93 |
| Bolling_Point: | 356.5±25.0 °C at 760 mmHg |
| FW: | 191.183 |
| PSA: | 57.61000 |
| Melting_Point: | 126-128 °C(lit.) |
| MF: | C10H9NO3 |
| Exact_Mass: | 191.058243 |
| Molecular_Structure: | ['1. Molar refractive index 485 ', '2. Molar volume 1376 ', '3. Parachor (902K)3862 ', '4. Surface tension 619 ', '5. Dielectric constant N/A ', '6. Polarizability 1922 ', '7. Single isotope mass 191058243Da ', '8. Nominal mass 191Da ', '9. Average mass 1911834Da'] |
| Density: | 1.4±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2925190090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)